C30H29NO6S — CID 58626283
5-benzyl-N-[4-(2-tert-butylphenyl)sulfonylphenyl]-2,3,4-trihydroxybenzamide (PubChem CID 58626283) has the molecular formula C30H29NO6S and a molecular weight of 531.63 g/mol. Its IUPAC name is 5-benzyl-N-[4-(2-tert-butylphenyl)sulfonylphenyl]-2,3,4-trihydroxybenzamide.
| Compound Name | 5-benzyl-N-[4-(2-tert-butylphenyl)sulfonylphenyl]-2,3,4-trihydroxybenzamide |
|---|---|
| PubChem CID | 58626283 |
| Molecular Formula | C30H29NO6S |
| Molecular Weight | 531.63 g/mol |
| Exact Mass | 531.17 |
| IUPAC Name | 5-benzyl-N-[4-(2-tert-butylphenyl)sulfonylphenyl]-2,3,4-trihydroxybenzamide |
| SMILES | CC(C)(C)c1ccccc1S(=O)(=O)c1ccc(NC(=O)c2cc(Cc3ccccc3)c(O)c(O)c2O)cc1 |
| InChI | InChI=1S/C30H29NO6S/c1-30(2,3)24-11-7-8-12-25(24)38(36,37)22-15-13-21(14-16-22)31-29(35)23-18-20(26(32)28(34)27(23)33)17-19-9-5-4-6-10-19/h4-16,18,32-34H,17H2,1-3H3,(H,31,35) |
| InChIKey | DGTSKVCDKOPWPQ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.63 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|