C35H38N2O5S2 — CID 143192254
5-(4-benzylpiperidin-1-yl)sulfanyl-N-[4-(2-tert-butylphenyl)sulfonylphenyl]-2,3-dihydroxybenzamide (PubChem CID 143192254) has the molecular formula C35H38N2O5S2 and a molecular weight of 630.83 g/mol. Its IUPAC name is 5-(4-benzylpiperidin-1-yl)sulfanyl-N-[4-(2-tert-butylphenyl)sulfonylphenyl]-2,3-dihydroxybenzamide.
| Compound Name | 5-(4-benzylpiperidin-1-yl)sulfanyl-N-[4-(2-tert-butylphenyl)sulfonylphenyl]-2,3-dihydroxybenzamide |
|---|---|
| PubChem CID | 143192254 |
| Molecular Formula | C35H38N2O5S2 |
| Molecular Weight | 630.83 g/mol |
| Exact Mass | 630.22 |
| IUPAC Name | 5-(4-benzylpiperidin-1-yl)sulfanyl-N-[4-(2-tert-butylphenyl)sulfonylphenyl]-2,3-dihydroxybenzamide |
| SMILES | CC(C)(C)c1ccccc1S(=O)(=O)c1ccc(NC(=O)c2cc(SN3CCC(Cc4ccccc4)CC3)cc(O)c2O)cc1 |
| InChI | InChI=1S/C35H38N2O5S2/c1-35(2,3)30-11-7-8-12-32(30)44(41,42)28-15-13-26(14-16-28)36-34(40)29-22-27(23-31(38)33(29)39)43-37-19-17-25(18-20-37)21-24-9-5-4-6-10-24/h4-16,22-23,25,38-39H,17-21H2,1-3H3,(H,36,40) |
| InChIKey | VMGCDUKQIYBRPM-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.83 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|