C37H41N3O8S2 — CID 58626273
5-(4-benzylpiperidin-1-yl)sulfonyl-N-[4-(4-benzylpiperidin-1-yl)sulfonyl-2-hydroxyphenyl]-2,3-dihydroxybenzamide (PubChem CID 58626273) has the molecular formula C37H41N3O8S2 and a molecular weight of 719.88 g/mol. Its IUPAC name is 5-(4-benzylpiperidin-1-yl)sulfonyl-N-[4-(4-benzylpiperidin-1-yl)sulfonyl-2-hydroxyphenyl]-2,3-dihydroxybenzamide.
| Compound Name | 5-(4-benzylpiperidin-1-yl)sulfonyl-N-[4-(4-benzylpiperidin-1-yl)sulfonyl-2-hydroxyphenyl]-2,3-dihydroxybenzamide |
|---|---|
| PubChem CID | 58626273 |
| Molecular Formula | C37H41N3O8S2 |
| Molecular Weight | 719.88 g/mol |
| Exact Mass | 719.23 |
| IUPAC Name | 5-(4-benzylpiperidin-1-yl)sulfonyl-N-[4-(4-benzylpiperidin-1-yl)sulfonyl-2-hydroxyphenyl]-2,3-dihydroxybenzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)N2CCC(Cc3ccccc3)CC2)cc1O)c1cc(S(=O)(=O)N2CCC(Cc3ccccc3)CC2)cc(O)c1O |
| InChI | InChI=1S/C37H41N3O8S2/c41-34-24-30(49(45,46)39-17-13-28(14-18-39)21-26-7-3-1-4-8-26)11-12-33(34)38-37(44)32-23-31(25-35(42)36(32)43)50(47,48)40-19-15-29(16-20-40)22-27-9-5-2-6-10-27/h1-12,23-25,28-29,41-43H,13-22H2,(H,38,44) |
| InChIKey | BJVMADNCTMJOBD-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 164.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.88 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|