C27H29FN2O3S — CID 5142544
5-(4-benzylpiperidin-1-yl)sulfonyl-N-(2,3-dimethylphenyl)-2-fluorobenzamide (PubChem CID 5142544) has the molecular formula C27H29FN2O3S and a molecular weight of 480.61 g/mol. Its IUPAC name is 5-(4-benzylpiperidin-1-yl)sulfonyl-N-(2,3-dimethylphenyl)-2-fluorobenzamide.
| Compound Name | 5-(4-benzylpiperidin-1-yl)sulfonyl-N-(2,3-dimethylphenyl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 5142544 |
| Molecular Formula | C27H29FN2O3S |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | 5-(4-benzylpiperidin-1-yl)sulfonyl-N-(2,3-dimethylphenyl)-2-fluorobenzamide |
| SMILES | Cc1cccc(NC(=O)c2cc(S(=O)(=O)N3CCC(Cc4ccccc4)CC3)ccc2F)c1C |
| InChI | InChI=1S/C27H29FN2O3S/c1-19-7-6-10-26(20(19)2)29-27(31)24-18-23(11-12-25(24)28)34(32,33)30-15-13-22(14-16-30)17-21-8-4-3-5-9-21/h3-12,18,22H,13-17H2,1-2H3,(H,29,31) |
| InChIKey | IXWIZYGYQQJLNK-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |