C33H29NO5S — CID 58626399
N-[4-(2-tert-butylphenyl)sulfonylphenyl]-2,3-dihydroxy-5-naphthalen-2-ylbenzamide (PubChem CID 58626399) has the molecular formula C33H29NO5S and a molecular weight of 551.66 g/mol. Its IUPAC name is N-[4-(2-tert-butylphenyl)sulfonylphenyl]-2,3-dihydroxy-5-naphthalen-2-ylbenzamide.
| Compound Name | N-[4-(2-tert-butylphenyl)sulfonylphenyl]-2,3-dihydroxy-5-naphthalen-2-ylbenzamide |
|---|---|
| PubChem CID | 58626399 |
| Molecular Formula | C33H29NO5S |
| Molecular Weight | 551.66 g/mol |
| Exact Mass | 551.18 |
| IUPAC Name | N-[4-(2-tert-butylphenyl)sulfonylphenyl]-2,3-dihydroxy-5-naphthalen-2-ylbenzamide |
| SMILES | CC(C)(C)c1ccccc1S(=O)(=O)c1ccc(NC(=O)c2cc(-c3ccc4ccccc4c3)cc(O)c2O)cc1 |
| InChI | InChI=1S/C33H29NO5S/c1-33(2,3)28-10-6-7-11-30(28)40(38,39)26-16-14-25(15-17-26)34-32(37)27-19-24(20-29(35)31(27)36)23-13-12-21-8-4-5-9-22(21)18-23/h4-20,35-36H,1-3H3,(H,34,37) |
| InChIKey | IOQWWMIMYMJWSR-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.66 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|