C22H23NO3S — CID 4046357
N-(4-tert-butylphenyl)-2-naphthalen-2-ylsulfonylacetamide (PubChem CID 4046357) has the molecular formula C22H23NO3S and a molecular weight of 381.50 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-2-naphthalen-2-ylsulfonylacetamide.
| Compound Name | N-(4-tert-butylphenyl)-2-naphthalen-2-ylsulfonylacetamide |
|---|---|
| PubChem CID | 4046357 |
| Molecular Formula | C22H23NO3S |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | N-(4-tert-butylphenyl)-2-naphthalen-2-ylsulfonylacetamide |
| SMILES | CC(C)(C)c1ccc(NC(=O)CS(=O)(=O)c2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C22H23NO3S/c1-22(2,3)18-9-11-19(12-10-18)23-21(24)15-27(25,26)20-13-8-16-6-4-5-7-17(16)14-20/h4-14H,15H2,1-3H3,(H,23,24) |
| InChIKey | BMZPTFLHUGRYSO-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |