C18H14FNO3S — CID 3925269
N-(3-fluorophenyl)-2-naphthalen-2-ylsulfonylacetamide (PubChem CID 3925269) has the molecular formula C18H14FNO3S and a molecular weight of 343.38 g/mol. Its IUPAC name is N-(3-fluorophenyl)-2-naphthalen-2-ylsulfonylacetamide.
| Compound Name | N-(3-fluorophenyl)-2-naphthalen-2-ylsulfonylacetamide |
|---|---|
| PubChem CID | 3925269 |
| Molecular Formula | C18H14FNO3S |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | N-(3-fluorophenyl)-2-naphthalen-2-ylsulfonylacetamide |
| SMILES | O=C(CS(=O)(=O)c1ccc2ccccc2c1)Nc1cccc(F)c1 |
| InChI | InChI=1S/C18H14FNO3S/c19-15-6-3-7-16(11-15)20-18(21)12-24(22,23)17-9-8-13-4-1-2-5-14(13)10-17/h1-11H,12H2,(H,20,21) |
| InChIKey | RRFCAESELXYINU-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |