C19H16BrNO3S — CID 3404538
N-(4-bromo-3-methylphenyl)-2-naphthalen-2-ylsulfonylacetamide (PubChem CID 3404538) has the molecular formula C19H16BrNO3S and a molecular weight of 418.31 g/mol. Its IUPAC name is N-(4-bromo-3-methylphenyl)-2-naphthalen-2-ylsulfonylacetamide.
| Compound Name | N-(4-bromo-3-methylphenyl)-2-naphthalen-2-ylsulfonylacetamide |
|---|---|
| PubChem CID | 3404538 |
| Molecular Formula | C19H16BrNO3S |
| Molecular Weight | 418.31 g/mol |
| Exact Mass | 417.00 |
| IUPAC Name | N-(4-bromo-3-methylphenyl)-2-naphthalen-2-ylsulfonylacetamide |
| SMILES | Cc1cc(NC(=O)CS(=O)(=O)c2ccc3ccccc3c2)ccc1Br |
| InChI | InChI=1S/C19H16BrNO3S/c1-13-10-16(7-9-18(13)20)21-19(22)12-25(23,24)17-8-6-14-4-2-3-5-15(14)11-17/h2-11H,12H2,1H3,(H,21,22) |
| InChIKey | BOZUTDBMZXRMFB-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.31 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |