C29H26BrN3O4S — CID 4016428
N-[4-[4-(3-bromobenzoyl)piperazin-1-yl]phenyl]-2-naphthalen-2-ylsulfonylacetamide (PubChem CID 4016428) has the molecular formula C29H26BrN3O4S and a molecular weight of 592.52 g/mol. Its IUPAC name is N-[4-[4-(3-bromobenzoyl)piperazin-1-yl]phenyl]-2-naphthalen-2-ylsulfonylacetamide.
| Compound Name | N-[4-[4-(3-bromobenzoyl)piperazin-1-yl]phenyl]-2-naphthalen-2-ylsulfonylacetamide |
|---|---|
| PubChem CID | 4016428 |
| Molecular Formula | C29H26BrN3O4S |
| Molecular Weight | 592.52 g/mol |
| Exact Mass | 591.08 |
| IUPAC Name | N-[4-[4-(3-bromobenzoyl)piperazin-1-yl]phenyl]-2-naphthalen-2-ylsulfonylacetamide |
| SMILES | O=C(CS(=O)(=O)c1ccc2ccccc2c1)Nc1ccc(N2CCN(C(=O)c3cccc(Br)c3)CC2)cc1 |
| InChI | InChI=1S/C29H26BrN3O4S/c30-24-7-3-6-23(18-24)29(35)33-16-14-32(15-17-33)26-11-9-25(10-12-26)31-28(34)20-38(36,37)27-13-8-21-4-1-2-5-22(21)19-27/h1-13,18-19H,14-17,20H2,(H,31,34) |
| InChIKey | JUGALLSUGMLAQP-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.52 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|