C29H25Cl2NO6S — CID 58626381
N-[2-chloro-5-(4-chlorophenyl)sulfonylphenyl]-2,3,4-trihydroxy-5-[(2-propan-2-ylphenyl)methyl]benzamide (PubChem CID 58626381) has the molecular formula C29H25Cl2NO6S and a molecular weight of 586.49 g/mol. Its IUPAC name is N-[2-chloro-5-(4-chlorophenyl)sulfonylphenyl]-2,3,4-trihydroxy-5-[(2-propan-2-ylphenyl)methyl]benzamide.
| Compound Name | N-[2-chloro-5-(4-chlorophenyl)sulfonylphenyl]-2,3,4-trihydroxy-5-[(2-propan-2-ylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 58626381 |
| Molecular Formula | C29H25Cl2NO6S |
| Molecular Weight | 586.49 g/mol |
| Exact Mass | 585.08 |
| IUPAC Name | N-[2-chloro-5-(4-chlorophenyl)sulfonylphenyl]-2,3,4-trihydroxy-5-[(2-propan-2-ylphenyl)methyl]benzamide |
| SMILES | CC(C)c1ccccc1Cc1cc(C(=O)Nc2cc(S(=O)(=O)c3ccc(Cl)cc3)ccc2Cl)c(O)c(O)c1O |
| InChI | InChI=1S/C29H25Cl2NO6S/c1-16(2)22-6-4-3-5-17(22)13-18-14-23(27(34)28(35)26(18)33)29(36)32-25-15-21(11-12-24(25)31)39(37,38)20-9-7-19(30)8-10-20/h3-12,14-16,33-35H,13H2,1-2H3,(H,32,36) |
| InChIKey | PRCQXJUFLNYVIU-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.49 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|