C31H29Cl2NO6S — CID 140502586
5-[2-(4-tert-butylphenyl)ethyl]-N-[2-chloro-3-(4-chlorophenyl)sulfonylphenyl]-2,3,4-trihydroxybenzamide (PubChem CID 140502586) has the molecular formula C31H29Cl2NO6S and a molecular weight of 614.55 g/mol. Its IUPAC name is 5-[2-(4-tert-butylphenyl)ethyl]-N-[2-chloro-3-(4-chlorophenyl)sulfonylphenyl]-2,3,4-trihydroxybenzamide.
| Compound Name | 5-[2-(4-tert-butylphenyl)ethyl]-N-[2-chloro-3-(4-chlorophenyl)sulfonylphenyl]-2,3,4-trihydroxybenzamide |
|---|---|
| PubChem CID | 140502586 |
| Molecular Formula | C31H29Cl2NO6S |
| Molecular Weight | 614.55 g/mol |
| Exact Mass | 613.11 |
| IUPAC Name | 5-[2-(4-tert-butylphenyl)ethyl]-N-[2-chloro-3-(4-chlorophenyl)sulfonylphenyl]-2,3,4-trihydroxybenzamide |
| SMILES | CC(C)(C)c1ccc(CCc2cc(C(=O)Nc3cccc(S(=O)(=O)c4ccc(Cl)cc4)c3Cl)c(O)c(O)c2O)cc1 |
| InChI | InChI=1S/C31H29Cl2NO6S/c1-31(2,3)20-11-8-18(9-12-20)7-10-19-17-23(28(36)29(37)27(19)35)30(38)34-24-5-4-6-25(26(24)33)41(39,40)22-15-13-21(32)14-16-22/h4-6,8-9,11-17,35-37H,7,10H2,1-3H3,(H,34,38) |
| InChIKey | XPUHCQAYZFHSQO-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.55 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|