C17H15ClNO3- — CID 22306821
3-[[2-(4-chlorophenyl)acetyl]amino]-2-ethylbenzoate (PubChem CID 22306821) has the molecular formula C17H15ClNO3- and a molecular weight of 316.76 g/mol. Its IUPAC name is 3-[[2-(4-chlorophenyl)acetyl]amino]-2-ethylbenzoate.
| Compound Name | 3-[[2-(4-chlorophenyl)acetyl]amino]-2-ethylbenzoate |
|---|---|
| PubChem CID | 22306821 |
| Molecular Formula | C17H15ClNO3- |
| Molecular Weight | 316.76 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 3-[[2-(4-chlorophenyl)acetyl]amino]-2-ethylbenzoate |
| SMILES | CCc1c(NC(=O)Cc2ccc(Cl)cc2)cccc1C(=O)[O-] |
| InChI | InChI=1S/C17H16ClNO3/c1-2-13-14(17(21)22)4-3-5-15(13)19-16(20)10-11-6-8-12(18)9-7-11/h3-9H,2,10H2,1H3,(H,19,20)(H,21,22)/p-1 |
| InChIKey | WOXBVUSKNXYHMC-UHFFFAOYSA-M |
| XLogP | 2.45 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.76 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |