C22H16ClN2O4- — CID 6980706
4-[[2-[[2-(4-chlorophenyl)acetyl]amino]benzoyl]amino]benzoate (PubChem CID 6980706) has the molecular formula C22H16ClN2O4- and a molecular weight of 407.83 g/mol. Its IUPAC name is 4-[[2-[[2-(4-chlorophenyl)acetyl]amino]benzoyl]amino]benzoate.
| Compound Name | 4-[[2-[[2-(4-chlorophenyl)acetyl]amino]benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 6980706 |
| Molecular Formula | C22H16ClN2O4- |
| Molecular Weight | 407.83 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | 4-[[2-[[2-(4-chlorophenyl)acetyl]amino]benzoyl]amino]benzoate |
| SMILES | O=C(Cc1ccc(Cl)cc1)Nc1ccccc1C(=O)Nc1ccc(C(=O)[O-])cc1 |
| InChI | InChI=1S/C22H17ClN2O4/c23-16-9-5-14(6-10-16)13-20(26)25-19-4-2-1-3-18(19)21(27)24-17-11-7-15(8-12-17)22(28)29/h1-12H,13H2,(H,24,27)(H,25,26)(H,28,29)/p-1 |
| InChIKey | PZZPNVLOWGWYIW-UHFFFAOYSA-M |
| XLogP | 3.14 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.83 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |