C19H13Cl2NO6S — CID 58626244
N-[2-chloro-5-(4-chlorophenyl)sulfonylphenyl]-2,3,4-trihydroxybenzamide (PubChem CID 58626244) has the molecular formula C19H13Cl2NO6S and a molecular weight of 454.29 g/mol. Its IUPAC name is N-[2-chloro-5-(4-chlorophenyl)sulfonylphenyl]-2,3,4-trihydroxybenzamide.
| Compound Name | N-[2-chloro-5-(4-chlorophenyl)sulfonylphenyl]-2,3,4-trihydroxybenzamide |
|---|---|
| PubChem CID | 58626244 |
| Molecular Formula | C19H13Cl2NO6S |
| Molecular Weight | 454.29 g/mol |
| Exact Mass | 452.98 |
| IUPAC Name | N-[2-chloro-5-(4-chlorophenyl)sulfonylphenyl]-2,3,4-trihydroxybenzamide |
| SMILES | O=C(Nc1cc(S(=O)(=O)c2ccc(Cl)cc2)ccc1Cl)c1ccc(O)c(O)c1O |
| InChI | InChI=1S/C19H13Cl2NO6S/c20-10-1-3-11(4-2-10)29(27,28)12-5-7-14(21)15(9-12)22-19(26)13-6-8-16(23)18(25)17(13)24/h1-9,23-25H,(H,22,26) |
| InChIKey | SPQPKBBEGOFRJG-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.29 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|