C29H34N2O8S — CID 58626377
methyl 3-methyl-2-[[4-[[2,3,4-trihydroxy-5-[(2-propan-2-ylphenyl)methyl]benzoyl]amino]phenyl]sulfonylamino]butanoate (PubChem CID 58626377) has the molecular formula C29H34N2O8S and a molecular weight of 570.66 g/mol. Its IUPAC name is methyl 3-methyl-2-[[4-[[2,3,4-trihydroxy-5-[(2-propan-2-ylphenyl)methyl]benzoyl]amino]phenyl]sulfonylamino]butanoate.
| Compound Name | methyl 3-methyl-2-[[4-[[2,3,4-trihydroxy-5-[(2-propan-2-ylphenyl)methyl]benzoyl]amino]phenyl]sulfonylamino]butanoate |
|---|---|
| PubChem CID | 58626377 |
| Molecular Formula | C29H34N2O8S |
| Molecular Weight | 570.66 g/mol |
| Exact Mass | 570.20 |
| IUPAC Name | methyl 3-methyl-2-[[4-[[2,3,4-trihydroxy-5-[(2-propan-2-ylphenyl)methyl]benzoyl]amino]phenyl]sulfonylamino]butanoate |
| SMILES | COC(=O)C(NS(=O)(=O)c1ccc(NC(=O)c2cc(Cc3ccccc3C(C)C)c(O)c(O)c2O)cc1)C(C)C |
| InChI | InChI=1S/C29H34N2O8S/c1-16(2)22-9-7-6-8-18(22)14-19-15-23(26(33)27(34)25(19)32)28(35)30-20-10-12-21(13-11-20)40(37,38)31-24(17(3)4)29(36)39-5/h6-13,15-17,24,31-34H,14H2,1-5H3,(H,30,35) |
| InChIKey | QZOXRBYWWABDDN-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 162.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.66 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|