C29H25NO6S — CID 58626428
N-(5,5-dioxodibenzothiophen-3-yl)-2,3,4-trihydroxy-5-[(2-propan-2-ylphenyl)methyl]benzamide (PubChem CID 58626428) has the molecular formula C29H25NO6S and a molecular weight of 515.59 g/mol. Its IUPAC name is N-(5,5-dioxodibenzothiophen-3-yl)-2,3,4-trihydroxy-5-[(2-propan-2-ylphenyl)methyl]benzamide.
| Compound Name | N-(5,5-dioxodibenzothiophen-3-yl)-2,3,4-trihydroxy-5-[(2-propan-2-ylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 58626428 |
| Molecular Formula | C29H25NO6S |
| Molecular Weight | 515.59 g/mol |
| Exact Mass | 515.14 |
| IUPAC Name | N-(5,5-dioxodibenzothiophen-3-yl)-2,3,4-trihydroxy-5-[(2-propan-2-ylphenyl)methyl]benzamide |
| SMILES | CC(C)c1ccccc1Cc1cc(C(=O)Nc2ccc3c(c2)S(=O)(=O)c2ccccc2-3)c(O)c(O)c1O |
| InChI | InChI=1S/C29H25NO6S/c1-16(2)20-8-4-3-7-17(20)13-18-14-23(27(32)28(33)26(18)31)29(34)30-19-11-12-22-21-9-5-6-10-24(21)37(35,36)25(22)15-19/h3-12,14-16,31-33H,13H2,1-2H3,(H,30,34) |
| InChIKey | CZZSOVDBGQETRN-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.59 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|