C26H16N4O8S — CID 2179848
2-nitro-N-[8-[(2-nitrobenzoyl)amino]-5,5-dioxodibenzothiophen-2-yl]benzamide (PubChem CID 2179848) has the molecular formula C26H16N4O8S and a molecular weight of 544.50 g/mol. Its IUPAC name is 2-nitro-N-[8-[(2-nitrobenzoyl)amino]-5,5-dioxodibenzothiophen-2-yl]benzamide.
| Compound Name | 2-nitro-N-[8-[(2-nitrobenzoyl)amino]-5,5-dioxodibenzothiophen-2-yl]benzamide |
|---|---|
| PubChem CID | 2179848 |
| Molecular Formula | C26H16N4O8S |
| Molecular Weight | 544.50 g/mol |
| Exact Mass | 544.07 |
| IUPAC Name | 2-nitro-N-[8-[(2-nitrobenzoyl)amino]-5,5-dioxodibenzothiophen-2-yl]benzamide |
| SMILES | O=C(Nc1ccc2c(c1)-c1cc(NC(=O)c3ccccc3[N+](=O)[O-])ccc1S2(=O)=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H16N4O8S/c31-25(17-5-1-3-7-21(17)29(33)34)27-15-9-11-23-19(13-15)20-14-16(10-12-24(20)39(23,37)38)28-26(32)18-6-2-4-8-22(18)30(35)36/h1-14H,(H,27,31)(H,28,32) |
| InChIKey | CKLNXJGSWICBAF-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 178.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.50 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|