C30H29NO5S — CID 143192327
2,3,4-trihydroxy-N-[2-methyl-5-[methylidene-(4-methylphenyl)-oxo-λ6-sulfanyl]phenyl]-5-(2-phenylethyl)benzamide (PubChem CID 143192327) has the molecular formula C30H29NO5S and a molecular weight of 515.63 g/mol. Its IUPAC name is 2,3,4-trihydroxy-N-[2-methyl-5-[methylidene-(4-methylphenyl)-oxo-λ6-sulfanyl]phenyl]-5-(2-phenylethyl)benzamide.
| Compound Name | 2,3,4-trihydroxy-N-[2-methyl-5-[methylidene-(4-methylphenyl)-oxo-λ6-sulfanyl]phenyl]-5-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 143192327 |
| Molecular Formula | C30H29NO5S |
| Molecular Weight | 515.63 g/mol |
| Exact Mass | 515.18 |
| IUPAC Name | 2,3,4-trihydroxy-N-[2-methyl-5-[methylidene-(4-methylphenyl)-oxo-λ6-sulfanyl]phenyl]-5-(2-phenylethyl)benzamide |
| SMILES | C=S(=O)(c1ccc(C)cc1)c1ccc(C)c(NC(=O)c2cc(CCc3ccccc3)c(O)c(O)c2O)c1 |
| InChI | InChI=1S/C30H29NO5S/c1-19-9-14-23(15-10-19)37(3,36)24-16-11-20(2)26(18-24)31-30(35)25-17-22(27(32)29(34)28(25)33)13-12-21-7-5-4-6-8-21/h4-11,14-18,32-34H,3,12-13H2,1-2H3,(H,31,35) |
| InChIKey | KTHRJTHYVMBHHS-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.63 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|