C28H39N5O4S — CID 21428026
1-(4-azidosulfonylphenyl)-3-[2-[3-tert-butyl-4-hydroxy-2-(3-propylcyclohexyl)phenyl]ethyl]urea (PubChem CID 21428026) has the molecular formula C28H39N5O4S and a molecular weight of 541.72 g/mol. Its IUPAC name is 1-(4-azidosulfonylphenyl)-3-[2-[3-tert-butyl-4-hydroxy-2-(3-propylcyclohexyl)phenyl]ethyl]urea.
| Compound Name | 1-(4-azidosulfonylphenyl)-3-[2-[3-tert-butyl-4-hydroxy-2-(3-propylcyclohexyl)phenyl]ethyl]urea |
|---|---|
| PubChem CID | 21428026 |
| Molecular Formula | C28H39N5O4S |
| Molecular Weight | 541.72 g/mol |
| Exact Mass | 541.27 |
| IUPAC Name | 1-(4-azidosulfonylphenyl)-3-[2-[3-tert-butyl-4-hydroxy-2-(3-propylcyclohexyl)phenyl]ethyl]urea |
| SMILES | CCCC1CCCC(c2c(CCNC(=O)Nc3ccc(S(=O)(=O)N=[N+]=[N-])cc3)ccc(O)c2C(C)(C)C)C1 |
| InChI | InChI=1S/C28H39N5O4S/c1-5-7-19-8-6-9-21(18-19)25-20(10-15-24(34)26(25)28(2,3)4)16-17-30-27(35)31-22-11-13-23(14-12-22)38(36,37)33-32-29/h10-15,19,21,34H,5-9,16-18H2,1-4H3,(H2,30,31,35) |
| InChIKey | RBBJSXNTGWRMSQ-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 144.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.72 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|