C27H28N2OS — CID 134273255
[2-ethynyl-4-[5-[2-(2-methylpropyl)-4-pyridinyl]thiophen-3-yl]phenyl]-piperidin-1-ylmethanone (PubChem CID 134273255) has the molecular formula C27H28N2OS and a molecular weight of 428.60 g/mol. Its IUPAC name is [2-ethynyl-4-[5-[2-(2-methylpropyl)-4-pyridinyl]thiophen-3-yl]phenyl]-piperidin-1-ylmethanone.
| Compound Name | [2-ethynyl-4-[5-[2-(2-methylpropyl)-4-pyridinyl]thiophen-3-yl]phenyl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 134273255 |
| Molecular Formula | C27H28N2OS |
| Molecular Weight | 428.60 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | [2-ethynyl-4-[5-[2-(2-methylpropyl)-4-pyridinyl]thiophen-3-yl]phenyl]-piperidin-1-ylmethanone |
| SMILES | C#Cc1cc(-c2csc(-c3ccnc(CC(C)C)c3)c2)ccc1C(=O)N1CCCCC1 |
| InChI | InChI=1S/C27H28N2OS/c1-4-20-15-21(8-9-25(20)27(30)29-12-6-5-7-13-29)23-17-26(31-18-23)22-10-11-28-24(16-22)14-19(2)3/h1,8-11,15-19H,5-7,12-14H2,2-3H3 |
| InChIKey | TYBDRAZDUOBUJV-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.60 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|