C24H25FN2OS — CID 134273313
[3-fluoro-4-[5-(2-propyl-4-pyridinyl)thiophen-3-yl]phenyl]-piperidin-1-ylmethanone (PubChem CID 134273313) has the molecular formula C24H25FN2OS and a molecular weight of 408.54 g/mol. Its IUPAC name is [3-fluoro-4-[5-(2-propyl-4-pyridinyl)thiophen-3-yl]phenyl]-piperidin-1-ylmethanone.
| Compound Name | [3-fluoro-4-[5-(2-propyl-4-pyridinyl)thiophen-3-yl]phenyl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 134273313 |
| Molecular Formula | C24H25FN2OS |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | [3-fluoro-4-[5-(2-propyl-4-pyridinyl)thiophen-3-yl]phenyl]-piperidin-1-ylmethanone |
| SMILES | CCCc1cc(-c2cc(-c3ccc(C(=O)N4CCCCC4)cc3F)cs2)ccn1 |
| InChI | InChI=1S/C24H25FN2OS/c1-2-6-20-13-17(9-10-26-20)23-15-19(16-29-23)21-8-7-18(14-22(21)25)24(28)27-11-4-3-5-12-27/h7-10,13-16H,2-6,11-12H2,1H3 |
| InChIKey | QTIDTUJTBZRYKD-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |