C24H20ClNOS2 — CID 134273296
[4-[5-(1-benzothiophen-3-yl)thiophen-3-yl]-3-chlorophenyl]-piperidin-1-ylmethanone (PubChem CID 134273296) has the molecular formula C24H20ClNOS2 and a molecular weight of 438.02 g/mol. Its IUPAC name is [4-[5-(1-benzothiophen-3-yl)thiophen-3-yl]-3-chlorophenyl]-piperidin-1-ylmethanone.
| Compound Name | [4-[5-(1-benzothiophen-3-yl)thiophen-3-yl]-3-chlorophenyl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 134273296 |
| Molecular Formula | C24H20ClNOS2 |
| Molecular Weight | 438.02 g/mol |
| Exact Mass | 437.07 |
| IUPAC Name | [4-[5-(1-benzothiophen-3-yl)thiophen-3-yl]-3-chlorophenyl]-piperidin-1-ylmethanone |
| SMILES | O=C(c1ccc(-c2csc(-c3csc4ccccc34)c2)c(Cl)c1)N1CCCCC1 |
| InChI | InChI=1S/C24H20ClNOS2/c25-21-12-16(24(27)26-10-4-1-5-11-26)8-9-18(21)17-13-23(28-14-17)20-15-29-22-7-3-2-6-19(20)22/h2-3,6-9,12-15H,1,4-5,10-11H2 |
| InChIKey | KYSGLDJLOSSVQX-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.02 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |