C21H26N2O2S — CID 24643105
azepan-1-yl-[1-(1-benzothiophene-3-carbonyl)piperidin-4-yl]methanone (PubChem CID 24643105) has the molecular formula C21H26N2O2S and a molecular weight of 370.52 g/mol. Its IUPAC name is azepan-1-yl-[1-(1-benzothiophene-3-carbonyl)piperidin-4-yl]methanone.
| Compound Name | azepan-1-yl-[1-(1-benzothiophene-3-carbonyl)piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 24643105 |
| Molecular Formula | C21H26N2O2S |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | azepan-1-yl-[1-(1-benzothiophene-3-carbonyl)piperidin-4-yl]methanone |
| SMILES | O=C(c1csc2ccccc12)N1CCC(C(=O)N2CCCCCC2)CC1 |
| InChI | InChI=1S/C21H26N2O2S/c24-20(22-11-5-1-2-6-12-22)16-9-13-23(14-10-16)21(25)18-15-26-19-8-4-3-7-17(18)19/h3-4,7-8,15-16H,1-2,5-6,9-14H2 |
| InChIKey | LXMOSANKPZYGCB-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |