C19H13F5N2OS — CID 134274669
2-fluoro-N-[2-fluoro-5-(trifluoromethyl)phenyl]sulfanyl-4-[(2-methyl-4-pyridinyl)oxy]aniline (PubChem CID 134274669) has the molecular formula C19H13F5N2OS and a molecular weight of 412.38 g/mol. Its IUPAC name is 2-fluoro-N-[2-fluoro-5-(trifluoromethyl)phenyl]sulfanyl-4-[(2-methyl-4-pyridinyl)oxy]aniline.
| Compound Name | 2-fluoro-N-[2-fluoro-5-(trifluoromethyl)phenyl]sulfanyl-4-[(2-methyl-4-pyridinyl)oxy]aniline |
|---|---|
| PubChem CID | 134274669 |
| Molecular Formula | C19H13F5N2OS |
| Molecular Weight | 412.38 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | 2-fluoro-N-[2-fluoro-5-(trifluoromethyl)phenyl]sulfanyl-4-[(2-methyl-4-pyridinyl)oxy]aniline |
| SMILES | Cc1cc(Oc2ccc(NSc3cc(C(F)(F)F)ccc3F)c(F)c2)ccn1 |
| InChI | InChI=1S/C19H13F5N2OS/c1-11-8-14(6-7-25-11)27-13-3-5-17(16(21)10-13)26-28-18-9-12(19(22,23)24)2-4-15(18)20/h2-10,26H,1H3 |
| InChIKey | BHOXJFOTWQMCRA-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.38 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|