C18H13F4N3OS — CID 169108586
2-fluoro-N-methylsulfanyl-4-[3-[4-(trifluoromethyl)phenoxy]pyrazin-2-yl]aniline (PubChem CID 169108586) has the molecular formula C18H13F4N3OS and a molecular weight of 395.38 g/mol. Its IUPAC name is 2-fluoro-N-methylsulfanyl-4-[3-[4-(trifluoromethyl)phenoxy]pyrazin-2-yl]aniline.
| Compound Name | 2-fluoro-N-methylsulfanyl-4-[3-[4-(trifluoromethyl)phenoxy]pyrazin-2-yl]aniline |
|---|---|
| PubChem CID | 169108586 |
| Molecular Formula | C18H13F4N3OS |
| Molecular Weight | 395.38 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | 2-fluoro-N-methylsulfanyl-4-[3-[4-(trifluoromethyl)phenoxy]pyrazin-2-yl]aniline |
| SMILES | CSNc1ccc(-c2nccnc2Oc2ccc(C(F)(F)F)cc2)cc1F |
| InChI | InChI=1S/C18H13F4N3OS/c1-27-25-15-7-2-11(10-14(15)19)16-17(24-9-8-23-16)26-13-5-3-12(4-6-13)18(20,21)22/h2-10,25H,1H3 |
| InChIKey | SXMDLSTWGHVWIL-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.38 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|