C18H13F4N3O3S — CID 169108748
N-[2-fluoro-4-[3-[4-(trifluoromethyl)phenoxy]pyrazin-2-yl]phenyl]methanesulfonamide (PubChem CID 169108748) has the molecular formula C18H13F4N3O3S and a molecular weight of 427.38 g/mol. Its IUPAC name is N-[2-fluoro-4-[3-[4-(trifluoromethyl)phenoxy]pyrazin-2-yl]phenyl]methanesulfonamide.
| Compound Name | N-[2-fluoro-4-[3-[4-(trifluoromethyl)phenoxy]pyrazin-2-yl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 169108748 |
| Molecular Formula | C18H13F4N3O3S |
| Molecular Weight | 427.38 g/mol |
| Exact Mass | 427.06 |
| IUPAC Name | N-[2-fluoro-4-[3-[4-(trifluoromethyl)phenoxy]pyrazin-2-yl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(-c2nccnc2Oc2ccc(C(F)(F)F)cc2)cc1F |
| InChI | InChI=1S/C18H13F4N3O3S/c1-29(26,27)25-15-7-2-11(10-14(15)19)16-17(24-9-8-23-16)28-13-5-3-12(4-6-13)18(20,21)22/h2-10,25H,1H3 |
| InChIKey | CWNNPDJJTSVBSH-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.38 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |