C18H12F3N5O3S — CID 169108288
[3-cyano-5-[3-[4-(trifluoromethyl)phenoxy]pyrazin-2-yl]-2-pyridinyl]methanesulfonamide (PubChem CID 169108288) has the molecular formula C18H12F3N5O3S and a molecular weight of 435.39 g/mol. Its IUPAC name is [3-cyano-5-[3-[4-(trifluoromethyl)phenoxy]pyrazin-2-yl]-2-pyridinyl]methanesulfonamide.
| Compound Name | [3-cyano-5-[3-[4-(trifluoromethyl)phenoxy]pyrazin-2-yl]-2-pyridinyl]methanesulfonamide |
|---|---|
| PubChem CID | 169108288 |
| Molecular Formula | C18H12F3N5O3S |
| Molecular Weight | 435.39 g/mol |
| Exact Mass | 435.06 |
| IUPAC Name | [3-cyano-5-[3-[4-(trifluoromethyl)phenoxy]pyrazin-2-yl]-2-pyridinyl]methanesulfonamide |
| SMILES | N#Cc1cc(-c2nccnc2Oc2ccc(C(F)(F)F)cc2)cnc1CS(N)(=O)=O |
| InChI | InChI=1S/C18H12F3N5O3S/c19-18(20,21)13-1-3-14(4-2-13)29-17-16(24-5-6-25-17)12-7-11(8-22)15(26-9-12)10-30(23,27)28/h1-7,9H,10H2,(H2,23,27,28) |
| InChIKey | PBRSLGPCINYWCW-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 131.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.39 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |