C21H16F3N2O2P — CID 169108639
2-[4-bis(ethenyl)phosphorylphenyl]-3-[4-(trifluoromethyl)phenoxy]pyrazine (PubChem CID 169108639) has the molecular formula C21H16F3N2O2P and a molecular weight of 416.34 g/mol. Its IUPAC name is 2-[4-bis(ethenyl)phosphorylphenyl]-3-[4-(trifluoromethyl)phenoxy]pyrazine.
| Compound Name | 2-[4-bis(ethenyl)phosphorylphenyl]-3-[4-(trifluoromethyl)phenoxy]pyrazine |
|---|---|
| PubChem CID | 169108639 |
| Molecular Formula | C21H16F3N2O2P |
| Molecular Weight | 416.34 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | 2-[4-bis(ethenyl)phosphorylphenyl]-3-[4-(trifluoromethyl)phenoxy]pyrazine |
| SMILES | C=CP(=O)(C=C)c1ccc(-c2nccnc2Oc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C21H16F3N2O2P/c1-3-29(27,4-2)18-11-5-15(6-12-18)19-20(26-14-13-25-19)28-17-9-7-16(8-10-17)21(22,23)24/h3-14H,1-2H2 |
| InChIKey | YQQSERTZHYSXOP-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.34 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|