C20H16F5N2OPS — CID 169108645
bis(ethenyl)-[4-[3-[4-(pentafluoro-λ6-sulfanyl)phenoxy]pyrazin-2-yl]phenyl]phosphane (PubChem CID 169108645) has the molecular formula C20H16F5N2OPS and a molecular weight of 458.39 g/mol. Its IUPAC name is bis(ethenyl)-[4-[3-[4-(pentafluoro-λ6-sulfanyl)phenoxy]pyrazin-2-yl]phenyl]phosphane.
| Compound Name | bis(ethenyl)-[4-[3-[4-(pentafluoro-λ6-sulfanyl)phenoxy]pyrazin-2-yl]phenyl]phosphane |
|---|---|
| PubChem CID | 169108645 |
| Molecular Formula | C20H16F5N2OPS |
| Molecular Weight | 458.39 g/mol |
| Exact Mass | 458.06 |
| IUPAC Name | bis(ethenyl)-[4-[3-[4-(pentafluoro-λ6-sulfanyl)phenoxy]pyrazin-2-yl]phenyl]phosphane |
| SMILES | C=CP(C=C)c1ccc(-c2nccnc2Oc2ccc(S(F)(F)(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C20H16F5N2OPS/c1-3-29(4-2)17-9-5-15(6-10-17)19-20(27-14-13-26-19)28-16-7-11-18(12-8-16)30(21,22,23,24)25/h3-14H,1-2H2 |
| InChIKey | IOLZVOFULIRILE-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.39 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|