C22H20F2NO2PS — CID 170093805
[4-[[3-[4-bis(ethenyl)phosphorylphenyl]-2-pyridinyl]oxy]phenyl]-difluoro-methyl-λ4-sulfane (PubChem CID 170093805) has the molecular formula C22H20F2NO2PS and a molecular weight of 431.44 g/mol. Its IUPAC name is [4-[[3-[4-bis(ethenyl)phosphorylphenyl]-2-pyridinyl]oxy]phenyl]-difluoro-methyl-λ4-sulfane.
| Compound Name | [4-[[3-[4-bis(ethenyl)phosphorylphenyl]-2-pyridinyl]oxy]phenyl]-difluoro-methyl-λ4-sulfane |
|---|---|
| PubChem CID | 170093805 |
| Molecular Formula | C22H20F2NO2PS |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | [4-[[3-[4-bis(ethenyl)phosphorylphenyl]-2-pyridinyl]oxy]phenyl]-difluoro-methyl-λ4-sulfane |
| SMILES | C=CP(=O)(C=C)c1ccc(-c2cccnc2Oc2ccc(S(C)(F)F)cc2)cc1 |
| InChI | InChI=1S/C22H20F2NO2PS/c1-4-28(26,5-2)19-12-8-17(9-13-19)21-7-6-16-25-22(21)27-18-10-14-20(15-11-18)29(3,23)24/h4-16H,1-2H2,3H3 |
| InChIKey | JGRSSXKPAZTQFV-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|