C21H14F3N3O — CID 169108194
6-[2-[4-(trifluoromethyl)phenoxy]-3-pyridinyl]isoquinolin-1-amine (PubChem CID 169108194) has the molecular formula C21H14F3N3O and a molecular weight of 381.36 g/mol. Its IUPAC name is 6-[2-[4-(trifluoromethyl)phenoxy]-3-pyridinyl]isoquinolin-1-amine.
| Compound Name | 6-[2-[4-(trifluoromethyl)phenoxy]-3-pyridinyl]isoquinolin-1-amine |
|---|---|
| PubChem CID | 169108194 |
| Molecular Formula | C21H14F3N3O |
| Molecular Weight | 381.36 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 6-[2-[4-(trifluoromethyl)phenoxy]-3-pyridinyl]isoquinolin-1-amine |
| SMILES | Nc1nccc2cc(-c3cccnc3Oc3ccc(C(F)(F)F)cc3)ccc12 |
| InChI | InChI=1S/C21H14F3N3O/c22-21(23,24)15-4-6-16(7-5-15)28-20-18(2-1-10-27-20)13-3-8-17-14(12-13)9-11-26-19(17)25/h1-12H,(H2,25,26) |
| InChIKey | IXXBYKIBZWIPNW-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.36 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |