C19H15CuF3IN2O — CID 161188768
iodocopper;3-[4-[2-methyl-4-(trifluoromethyl)phenoxy]phenyl]pyridin-2-amine (PubChem CID 161188768) has the molecular formula C19H15CuF3IN2O and a molecular weight of 534.79 g/mol. Its IUPAC name is iodocopper;3-[4-[2-methyl-4-(trifluoromethyl)phenoxy]phenyl]pyridin-2-amine.
| Compound Name | iodocopper;3-[4-[2-methyl-4-(trifluoromethyl)phenoxy]phenyl]pyridin-2-amine |
|---|---|
| PubChem CID | 161188768 |
| Molecular Formula | C19H15CuF3IN2O |
| Molecular Weight | 534.79 g/mol |
| Exact Mass | 533.95 |
| IUPAC Name | iodocopper;3-[4-[2-methyl-4-(trifluoromethyl)phenoxy]phenyl]pyridin-2-amine |
| SMILES | Cc1cc(C(F)(F)F)ccc1Oc1ccc(-c2cccnc2N)cc1.[Cu]I |
| InChI | InChI=1S/C19H15F3N2O.Cu.HI/c1-12-11-14(19(20,21)22)6-9-17(12)25-15-7-4-13(5-8-15)16-3-2-10-24-18(16)23;;/h2-11H,1H3,(H2,23,24);;1H/q;+1;/p-1 |
| InChIKey | UTLARHUXSVTMIR-UHFFFAOYSA-M |
| XLogP | 6.33 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.79 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|