C27H35N3O2 — CID 134274856
2-(benzotriazol-1-yl)-1-[(1R,2R,5S,8R,11R,12S,15S,16S)-5-hydroxy-16-methyl-15-pentacyclo[9.7.0.02,8.05,7.012,16]octadecanyl]ethanone (PubChem CID 134274856) has the molecular formula C27H35N3O2 and a molecular weight of 433.60 g/mol. Its IUPAC name is 2-(benzotriazol-1-yl)-1-[(1R,2R,5S,8R,11R,12S,15S,16S)-5-hydroxy-16-methyl-15-pentacyclo[9.7.0.02,8.05,7.012,16]octadecanyl]ethanone.
| Compound Name | 2-(benzotriazol-1-yl)-1-[(1R,2R,5S,8R,11R,12S,15S,16S)-5-hydroxy-16-methyl-15-pentacyclo[9.7.0.02,8.05,7.012,16]octadecanyl]ethanone |
|---|---|
| PubChem CID | 134274856 |
| Molecular Formula | C27H35N3O2 |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.27 |
| IUPAC Name | 2-(benzotriazol-1-yl)-1-[(1R,2R,5S,8R,11R,12S,15S,16S)-5-hydroxy-16-methyl-15-pentacyclo[9.7.0.02,8.05,7.012,16]octadecanyl]ethanone |
| SMILES | C[C@]12CC[C@@H]3[C@H]4CC[C@]5(O)CC5[C@@H]4CC[C@H]3[C@@H]1CC[C@@H]2C(=O)Cn1nnc2ccccc21 |
| InChI | InChI=1S/C27H35N3O2/c1-26-12-10-16-17-11-13-27(32)14-22(27)19(17)7-6-18(16)20(26)8-9-21(26)25(31)15-30-24-5-3-2-4-23(24)28-29-30/h2-5,16-22,32H,6-15H2,1H3/t16-,17-,18-,19-,20+,21-,22?,26+,27+/m1/s1 |
| InChIKey | OIPCVJXTOQVGEH-KUWUQVIWSA-N |
| XLogP | 4.63 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |