C23H33N3O2 — CID 146547741
1-[(1R,2R,5S,8R,11R,12S,15S,16S)-5-hydroxy-16-methyl-15-pentacyclo[9.7.0.02,8.05,7.012,16]octadecanyl]-2-(triazol-1-yl)ethanone (PubChem CID 146547741) has the molecular formula C23H33N3O2 and a molecular weight of 383.54 g/mol. Its IUPAC name is 1-[(1R,2R,5S,8R,11R,12S,15S,16S)-5-hydroxy-16-methyl-15-pentacyclo[9.7.0.02,8.05,7.012,16]octadecanyl]-2-(triazol-1-yl)ethanone.
| Compound Name | 1-[(1R,2R,5S,8R,11R,12S,15S,16S)-5-hydroxy-16-methyl-15-pentacyclo[9.7.0.02,8.05,7.012,16]octadecanyl]-2-(triazol-1-yl)ethanone |
|---|---|
| PubChem CID | 146547741 |
| Molecular Formula | C23H33N3O2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.26 |
| IUPAC Name | 1-[(1R,2R,5S,8R,11R,12S,15S,16S)-5-hydroxy-16-methyl-15-pentacyclo[9.7.0.02,8.05,7.012,16]octadecanyl]-2-(triazol-1-yl)ethanone |
| SMILES | C[C@]12CC[C@@H]3[C@H]4CC[C@]5(O)CC5[C@@H]4CC[C@H]3[C@@H]1CC[C@@H]2C(=O)Cn1ccnn1 |
| InChI | InChI=1S/C23H33N3O2/c1-22-8-6-14-15-7-9-23(28)12-20(23)17(15)3-2-16(14)18(22)4-5-19(22)21(27)13-26-11-10-24-25-26/h10-11,14-20,28H,2-9,12-13H2,1H3/t14-,15-,16-,17-,18+,19-,20?,22+,23+/m1/s1 |
| InChIKey | SWAUGZYTIBYHCA-MSVCXKRVSA-N |
| XLogP | 3.48 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |