C25H37N3O3 — CID 135175814
1-[(1R,2R,5R,8R,11R,12S,15S,16S)-6-ethoxy-5-hydroxy-16-methyl-15-pentacyclo[9.7.0.02,8.05,7.012,16]octadecanyl]-2-(triazol-1-yl)ethanone (PubChem CID 135175814) has the molecular formula C25H37N3O3 and a molecular weight of 427.59 g/mol. Its IUPAC name is 1-[(1R,2R,5R,8R,11R,12S,15S,16S)-6-ethoxy-5-hydroxy-16-methyl-15-pentacyclo[9.7.0.02,8.05,7.012,16]octadecanyl]-2-(triazol-1-yl)ethanone.
| Compound Name | 1-[(1R,2R,5R,8R,11R,12S,15S,16S)-6-ethoxy-5-hydroxy-16-methyl-15-pentacyclo[9.7.0.02,8.05,7.012,16]octadecanyl]-2-(triazol-1-yl)ethanone |
|---|---|
| PubChem CID | 135175814 |
| Molecular Formula | C25H37N3O3 |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.28 |
| IUPAC Name | 1-[(1R,2R,5R,8R,11R,12S,15S,16S)-6-ethoxy-5-hydroxy-16-methyl-15-pentacyclo[9.7.0.02,8.05,7.012,16]octadecanyl]-2-(triazol-1-yl)ethanone |
| SMILES | CCOC1C2[C@@H]3CC[C@@H]4[C@H](CC[C@]5(C)[C@@H](C(=O)Cn6ccnn6)CC[C@@H]45)[C@H]3CC[C@]12O |
| InChI | InChI=1S/C25H37N3O3/c1-3-31-23-22-18-5-4-17-15(16(18)9-11-25(22,23)30)8-10-24(2)19(17)6-7-20(24)21(29)14-28-13-12-26-27-28/h12-13,15-20,22-23,30H,3-11,14H2,1-2H3/t15-,16-,17-,18-,19+,20-,22?,23?,24+,25-/m1/s1 |
| InChIKey | DQMBTJJUKFBKRB-LAPXVASBSA-N |
| XLogP | 3.49 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |