C28H27F3N6O — CID 134276017
[(3S,4S)-3-methyl-1-(7-phenylquinolin-4-yl)piperidin-4-yl]-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone (PubChem CID 134276017) has the molecular formula C28H27F3N6O and a molecular weight of 520.56 g/mol. Its IUPAC name is [(3S,4S)-3-methyl-1-(7-phenylquinolin-4-yl)piperidin-4-yl]-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone.
| Compound Name | [(3S,4S)-3-methyl-1-(7-phenylquinolin-4-yl)piperidin-4-yl]-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone |
|---|---|
| PubChem CID | 134276017 |
| Molecular Formula | C28H27F3N6O |
| Molecular Weight | 520.56 g/mol |
| Exact Mass | 520.22 |
| IUPAC Name | [(3S,4S)-3-methyl-1-(7-phenylquinolin-4-yl)piperidin-4-yl]-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone |
| SMILES | C[C@@H]1CN(c2ccnc3cc(-c4ccccc4)ccc23)CC[C@@H]1C(=O)N1CCn2c(nnc2C(F)(F)F)C1 |
| InChI | InChI=1S/C28H27F3N6O/c1-18-16-35(24-9-11-32-23-15-20(7-8-22(23)24)19-5-3-2-4-6-19)12-10-21(18)26(38)36-13-14-37-25(17-36)33-34-27(37)28(29,30)31/h2-9,11,15,18,21H,10,12-14,16-17H2,1H3/t18-,21+/m1/s1 |
| InChIKey | HQEBJBLVDASUTO-NQIIRXRSSA-N |
| XLogP | 5.02 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.56 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |