C25H26F2N6O3 — CID 134277420
N-[[2-(1,1-difluorobutyl)-4-(2-oxo-1,3-dihydroimidazo[4,5-b]pyridin-7-yl)phenyl]methyl]-N-methyl-3-(1-methylcyclopropyl)-1,2,4-oxadiazole-5-carboxamide (PubChem CID 134277420) has the molecular formula C25H26F2N6O3 and a molecular weight of 496.52 g/mol. Its IUPAC name is N-[[2-(1,1-difluorobutyl)-4-(2-oxo-1,3-dihydroimidazo[4,5-b]pyridin-7-yl)phenyl]methyl]-N-methyl-3-(1-methylcyclopropyl)-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | N-[[2-(1,1-difluorobutyl)-4-(2-oxo-1,3-dihydroimidazo[4,5-b]pyridin-7-yl)phenyl]methyl]-N-methyl-3-(1-methylcyclopropyl)-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 134277420 |
| Molecular Formula | C25H26F2N6O3 |
| Molecular Weight | 496.52 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | N-[[2-(1,1-difluorobutyl)-4-(2-oxo-1,3-dihydroimidazo[4,5-b]pyridin-7-yl)phenyl]methyl]-N-methyl-3-(1-methylcyclopropyl)-1,2,4-oxadiazole-5-carboxamide |
| SMILES | CCCC(F)(F)c1cc(-c2ccnc3[nH]c(=O)[nH]c23)ccc1CN(C)C(=O)c1nc(C2(C)CC2)no1 |
| InChI | InChI=1S/C25H26F2N6O3/c1-4-8-25(26,27)17-12-14(16-7-11-28-19-18(16)29-23(35)30-19)5-6-15(17)13-33(3)21(34)20-31-22(32-36-20)24(2)9-10-24/h5-7,11-12H,4,8-10,13H2,1-3H3,(H2,28,29,30,35) |
| InChIKey | ZLTJHZGZFADTKZ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.52 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |