C14H20N4O2 — CID 134277515
ethyl N-[(6aR)-6,6a,7,8,9,10-hexahydro-5H-pyrazino[1,2-a][1,8]naphthyridin-4-yl]carbamate (PubChem CID 134277515) has the molecular formula C14H20N4O2 and a molecular weight of 276.34 g/mol. Its IUPAC name is ethyl N-[(6aR)-6,6a,7,8,9,10-hexahydro-5H-pyrazino[1,2-a][1,8]naphthyridin-4-yl]carbamate.
| Compound Name | ethyl N-[(6aR)-6,6a,7,8,9,10-hexahydro-5H-pyrazino[1,2-a][1,8]naphthyridin-4-yl]carbamate |
|---|---|
| PubChem CID | 134277515 |
| Molecular Formula | C14H20N4O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | ethyl N-[(6aR)-6,6a,7,8,9,10-hexahydro-5H-pyrazino[1,2-a][1,8]naphthyridin-4-yl]carbamate |
| SMILES | CCOC(=O)Nc1ccnc2c1CC[C@@H]1CNCCN21 |
| InChI | InChI=1S/C14H20N4O2/c1-2-20-14(19)17-12-5-6-16-13-11(12)4-3-10-9-15-7-8-18(10)13/h5-6,10,15H,2-4,7-9H2,1H3,(H,16,17,19)/t10-/m1/s1 |
| InChIKey | CNUJPMHMFCJDBA-SNVBAGLBSA-N |
| XLogP | 1.37 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |