C11H15ClN4S — CID 134265666
(10R)-6-chloro-4-methylsulfanyl-1,3,5,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-triene (PubChem CID 134265666) has the molecular formula C11H15ClN4S and a molecular weight of 270.79 g/mol. Its IUPAC name is (10R)-6-chloro-4-methylsulfanyl-1,3,5,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-triene.
| Compound Name | (10R)-6-chloro-4-methylsulfanyl-1,3,5,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 134265666 |
| Molecular Formula | C11H15ClN4S |
| Molecular Weight | 270.79 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | (10R)-6-chloro-4-methylsulfanyl-1,3,5,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-triene |
| SMILES | CSc1nc(Cl)c2c(n1)N1CCNC[C@H]1CC2 |
| InChI | InChI=1S/C11H15ClN4S/c1-17-11-14-9(12)8-3-2-7-6-13-4-5-16(7)10(8)15-11/h7,13H,2-6H2,1H3/t7-/m1/s1 |
| InChIKey | GSIMGGRPVGMDAW-SSDOTTSWSA-N |
| XLogP | 1.58 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.79 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |