C18H35N5 — CID 176926717
ethane;4-methyl-6-propan-2-yl-1,3,5,8,13-pentazatricyclo[9.4.0.02,7]pentadeca-2,4,6-triene (PubChem CID 176926717) has the molecular formula C18H35N5 and a molecular weight of 321.51 g/mol. Its IUPAC name is ethane;4-methyl-6-propan-2-yl-1,3,5,8,13-pentazatricyclo[9.4.0.02,7]pentadeca-2,4,6-triene.
| Compound Name | ethane;4-methyl-6-propan-2-yl-1,3,5,8,13-pentazatricyclo[9.4.0.02,7]pentadeca-2,4,6-triene |
|---|---|
| PubChem CID | 176926717 |
| Molecular Formula | C18H35N5 |
| Molecular Weight | 321.51 g/mol |
| Exact Mass | 321.29 |
| IUPAC Name | ethane;4-methyl-6-propan-2-yl-1,3,5,8,13-pentazatricyclo[9.4.0.02,7]pentadeca-2,4,6-triene |
| SMILES | CC.CC.Cc1nc(C(C)C)c2c(n1)N1CCNCC1CCN2 |
| InChI | InChI=1S/C14H23N5.2C2H6/c1-9(2)12-13-14(18-10(3)17-12)19-7-6-15-8-11(19)4-5-16-13;2*1-2/h9,11,15-16H,4-8H2,1-3H3;2*1-2H3 |
| InChIKey | PPGZQDSXVDTRIF-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.51 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |