C14H21N5O — CID 176926942
4-ethyl-2-propan-2-yl-5,6a,7,8,9,10-hexahydropyrazino[2,1-h]pteridin-6-one (PubChem CID 176926942) has the molecular formula C14H21N5O and a molecular weight of 275.36 g/mol. Its IUPAC name is 4-ethyl-2-propan-2-yl-5,6a,7,8,9,10-hexahydropyrazino[2,1-h]pteridin-6-one.
| Compound Name | 4-ethyl-2-propan-2-yl-5,6a,7,8,9,10-hexahydropyrazino[2,1-h]pteridin-6-one |
|---|---|
| PubChem CID | 176926942 |
| Molecular Formula | C14H21N5O |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 4-ethyl-2-propan-2-yl-5,6a,7,8,9,10-hexahydropyrazino[2,1-h]pteridin-6-one |
| SMILES | CCc1nc(C(C)C)nc2c1NC(=O)C1CNCCN21 |
| InChI | InChI=1S/C14H21N5O/c1-4-9-11-13(18-12(16-9)8(2)3)19-6-5-15-7-10(19)14(20)17-11/h8,10,15H,4-7H2,1-3H3,(H,17,20) |
| InChIKey | QAPKWSDMIVEGQP-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |