C23H25F2N7O2 — CID 167622836
(6aR)-2-[2-[1-[(3,5-difluoro-4-methoxyphenyl)methyl]pyrazol-4-yl]ethyl]-4-methyl-5,6a,7,8,9,10-hexahydropyrazino[2,1-h]pteridin-6-one (PubChem CID 167622836) has the molecular formula C23H25F2N7O2 and a molecular weight of 469.50 g/mol. Its IUPAC name is (6aR)-2-[2-[1-[(3,5-difluoro-4-methoxyphenyl)methyl]pyrazol-4-yl]ethyl]-4-methyl-5,6a,7,8,9,10-hexahydropyrazino[2,1-h]pteridin-6-one.
| Compound Name | (6aR)-2-[2-[1-[(3,5-difluoro-4-methoxyphenyl)methyl]pyrazol-4-yl]ethyl]-4-methyl-5,6a,7,8,9,10-hexahydropyrazino[2,1-h]pteridin-6-one |
|---|---|
| PubChem CID | 167622836 |
| Molecular Formula | C23H25F2N7O2 |
| Molecular Weight | 469.50 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | (6aR)-2-[2-[1-[(3,5-difluoro-4-methoxyphenyl)methyl]pyrazol-4-yl]ethyl]-4-methyl-5,6a,7,8,9,10-hexahydropyrazino[2,1-h]pteridin-6-one |
| SMILES | COc1c(F)cc(Cn2cc(CCc3nc(C)c4c(n3)N3CCNC[C@@H]3C(=O)N4)cn2)cc1F |
| InChI | InChI=1S/C23H25F2N7O2/c1-13-20-22(32-6-5-26-10-18(32)23(33)30-20)29-19(28-13)4-3-14-9-27-31(11-14)12-15-7-16(24)21(34-2)17(25)8-15/h7-9,11,18,26H,3-6,10,12H2,1-2H3,(H,30,33)/t18-/m1/s1 |
| InChIKey | RAMBYWXNEFNYNV-GOSISDBHSA-N |
| XLogP | 1.83 |
| TPSA | 97.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.50 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |