C20H19F3N6O — CID 159957691
4,8-dimethyl-2-[2-[1-[(3,4,5-trifluorophenyl)methyl]pyrazol-4-yl]ethyl]-5,7-dihydropteridin-6-one (PubChem CID 159957691) has the molecular formula C20H19F3N6O and a molecular weight of 416.41 g/mol. Its IUPAC name is 4,8-dimethyl-2-[2-[1-[(3,4,5-trifluorophenyl)methyl]pyrazol-4-yl]ethyl]-5,7-dihydropteridin-6-one.
| Compound Name | 4,8-dimethyl-2-[2-[1-[(3,4,5-trifluorophenyl)methyl]pyrazol-4-yl]ethyl]-5,7-dihydropteridin-6-one |
|---|---|
| PubChem CID | 159957691 |
| Molecular Formula | C20H19F3N6O |
| Molecular Weight | 416.41 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 4,8-dimethyl-2-[2-[1-[(3,4,5-trifluorophenyl)methyl]pyrazol-4-yl]ethyl]-5,7-dihydropteridin-6-one |
| SMILES | Cc1nc(CCc2cnn(Cc3cc(F)c(F)c(F)c3)c2)nc2c1NC(=O)CN2C |
| InChI | InChI=1S/C20H19F3N6O/c1-11-19-20(28(2)10-17(30)27-19)26-16(25-11)4-3-12-7-24-29(8-12)9-13-5-14(21)18(23)15(22)6-13/h5-8H,3-4,9-10H2,1-2H3,(H,27,30) |
| InChIKey | OCXQLMUJLSKQPB-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.41 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|