C22H23F3N6OS — CID 158019168
(6aS)-4-methyl-2-[2-[1-[(3,4,5-trifluorophenyl)methyl]pyrazol-4-yl]ethyl]-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-h]pteridin-6-one;sulfane (PubChem CID 158019168) has the molecular formula C22H23F3N6OS and a molecular weight of 476.53 g/mol. Its IUPAC name is (6aS)-4-methyl-2-[2-[1-[(3,4,5-trifluorophenyl)methyl]pyrazol-4-yl]ethyl]-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-h]pteridin-6-one;sulfane.
| Compound Name | (6aS)-4-methyl-2-[2-[1-[(3,4,5-trifluorophenyl)methyl]pyrazol-4-yl]ethyl]-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-h]pteridin-6-one;sulfane |
|---|---|
| PubChem CID | 158019168 |
| Molecular Formula | C22H23F3N6OS |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | (6aS)-4-methyl-2-[2-[1-[(3,4,5-trifluorophenyl)methyl]pyrazol-4-yl]ethyl]-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-h]pteridin-6-one;sulfane |
| SMILES | Cc1nc(CCc2cnn(Cc3cc(F)c(F)c(F)c3)c2)nc2c1NC(=O)[C@@H]1CCCN21.S |
| InChI | InChI=1S/C22H21F3N6O.H2S/c1-12-20-21(31-6-2-3-17(31)22(32)29-20)28-18(27-12)5-4-13-9-26-30(10-13)11-14-7-15(23)19(25)16(24)8-14;/h7-10,17H,2-6,11H2,1H3,(H,29,32);1H2/t17-;/m0./s1 |
| InChIKey | FFVUWVPHPIZABW-LMOVPXPDSA-N |
| XLogP | 3.27 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|