C21H20F3N7O2 — CID 146203367
(6aS,8R)-8-hydroxy-4-methyl-2-[[1-[(3,4,5-trifluorophenyl)methyl]pyrazol-4-yl]methylamino]-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-h]pteridin-6-one (PubChem CID 146203367) has the molecular formula C21H20F3N7O2 and a molecular weight of 459.43 g/mol. Its IUPAC name is (6aS,8R)-8-hydroxy-4-methyl-2-[[1-[(3,4,5-trifluorophenyl)methyl]pyrazol-4-yl]methylamino]-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-h]pteridin-6-one.
| Compound Name | (6aS,8R)-8-hydroxy-4-methyl-2-[[1-[(3,4,5-trifluorophenyl)methyl]pyrazol-4-yl]methylamino]-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-h]pteridin-6-one |
|---|---|
| PubChem CID | 146203367 |
| Molecular Formula | C21H20F3N7O2 |
| Molecular Weight | 459.43 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | (6aS,8R)-8-hydroxy-4-methyl-2-[[1-[(3,4,5-trifluorophenyl)methyl]pyrazol-4-yl]methylamino]-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-h]pteridin-6-one |
| SMILES | Cc1nc(NCc2cnn(Cc3cc(F)c(F)c(F)c3)c2)nc2c1NC(=O)[C@@H]1C[C@@H](O)CN21 |
| InChI | InChI=1S/C21H20F3N7O2/c1-10-18-19(31-9-13(32)4-16(31)20(33)28-18)29-21(27-10)25-5-12-6-26-30(8-12)7-11-2-14(22)17(24)15(23)3-11/h2-3,6,8,13,16,32H,4-5,7,9H2,1H3,(H,28,33)(H,25,27,29)/t13-,16+/m1/s1 |
| InChIKey | BZQNPQIFKOQFFU-CJNGLKHVSA-N |
| XLogP | 1.95 |
| TPSA | 108.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.43 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|