C21H24F3N7O — CID 146202306
(7S)-4,7,8-trimethyl-2-[[1-[2-(3,4,5-trifluorophenyl)ethyl]pyrazol-4-yl]methylamino]-6,7-dihydro-5H-pteridin-6-ol (PubChem CID 146202306) has the molecular formula C21H24F3N7O and a molecular weight of 447.47 g/mol. Its IUPAC name is (7S)-4,7,8-trimethyl-2-[[1-[2-(3,4,5-trifluorophenyl)ethyl]pyrazol-4-yl]methylamino]-6,7-dihydro-5H-pteridin-6-ol.
| Compound Name | (7S)-4,7,8-trimethyl-2-[[1-[2-(3,4,5-trifluorophenyl)ethyl]pyrazol-4-yl]methylamino]-6,7-dihydro-5H-pteridin-6-ol |
|---|---|
| PubChem CID | 146202306 |
| Molecular Formula | C21H24F3N7O |
| Molecular Weight | 447.47 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | (7S)-4,7,8-trimethyl-2-[[1-[2-(3,4,5-trifluorophenyl)ethyl]pyrazol-4-yl]methylamino]-6,7-dihydro-5H-pteridin-6-ol |
| SMILES | Cc1nc(NCc2cnn(CCc3cc(F)c(F)c(F)c3)c2)nc2c1NC(O)[C@H](C)N2C |
| InChI | InChI=1S/C21H24F3N7O/c1-11-18-19(30(3)12(2)20(32)28-18)29-21(27-11)25-8-14-9-26-31(10-14)5-4-13-6-15(22)17(24)16(23)7-13/h6-7,9-10,12,20,28,32H,4-5,8H2,1-3H3,(H,25,27,29)/t12-,20?/m0/s1 |
| InChIKey | SMVRNFCWBOHNRD-SVZXGPMESA-N |
| XLogP | 2.82 |
| TPSA | 91.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.47 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|