C23H25F3N6O — CID 159294376
(7S)-7,8-diethyl-5-methyl-2-[2-[1-[(3,4,5-trifluorophenyl)methyl]pyrazol-4-yl]ethyl]-7H-pteridin-6-one (PubChem CID 159294376) has the molecular formula C23H25F3N6O and a molecular weight of 458.49 g/mol. Its IUPAC name is (7S)-7,8-diethyl-5-methyl-2-[2-[1-[(3,4,5-trifluorophenyl)methyl]pyrazol-4-yl]ethyl]-7H-pteridin-6-one.
| Compound Name | (7S)-7,8-diethyl-5-methyl-2-[2-[1-[(3,4,5-trifluorophenyl)methyl]pyrazol-4-yl]ethyl]-7H-pteridin-6-one |
|---|---|
| PubChem CID | 159294376 |
| Molecular Formula | C23H25F3N6O |
| Molecular Weight | 458.49 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | (7S)-7,8-diethyl-5-methyl-2-[2-[1-[(3,4,5-trifluorophenyl)methyl]pyrazol-4-yl]ethyl]-7H-pteridin-6-one |
| SMILES | CC[C@H]1C(=O)N(C)c2cnc(CCc3cnn(Cc4cc(F)c(F)c(F)c4)c3)nc2N1CC |
| InChI | InChI=1S/C23H25F3N6O/c1-4-18-23(33)30(3)19-11-27-20(29-22(19)32(18)5-2)7-6-14-10-28-31(12-14)13-15-8-16(24)21(26)17(25)9-15/h8-12,18H,4-7,13H2,1-3H3/t18-/m0/s1 |
| InChIKey | YUGMIZOFXCOAFZ-SFHVURJKSA-N |
| XLogP | 3.51 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.49 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|