C22H21F6N7O — CID 175601702
(7S)-7-ethyl-5-methyl-8-(1,2,2-trifluoroethyl)-2-[[1-[(3,4,5-trifluorophenyl)methyl]pyrazol-4-yl]methylamino]-7H-pteridin-6-one (PubChem CID 175601702) has the molecular formula C22H21F6N7O and a molecular weight of 513.45 g/mol. Its IUPAC name is (7S)-7-ethyl-5-methyl-8-(1,2,2-trifluoroethyl)-2-[[1-[(3,4,5-trifluorophenyl)methyl]pyrazol-4-yl]methylamino]-7H-pteridin-6-one.
| Compound Name | (7S)-7-ethyl-5-methyl-8-(1,2,2-trifluoroethyl)-2-[[1-[(3,4,5-trifluorophenyl)methyl]pyrazol-4-yl]methylamino]-7H-pteridin-6-one |
|---|---|
| PubChem CID | 175601702 |
| Molecular Formula | C22H21F6N7O |
| Molecular Weight | 513.45 g/mol |
| Exact Mass | 513.17 |
| IUPAC Name | (7S)-7-ethyl-5-methyl-8-(1,2,2-trifluoroethyl)-2-[[1-[(3,4,5-trifluorophenyl)methyl]pyrazol-4-yl]methylamino]-7H-pteridin-6-one |
| SMILES | CC[C@H]1C(=O)N(C)c2cnc(NCc3cnn(Cc4cc(F)c(F)c(F)c4)c3)nc2N1C(F)C(F)F |
| InChI | InChI=1S/C22H21F6N7O/c1-3-15-21(36)33(2)16-8-30-22(32-20(16)35(15)19(28)18(26)27)29-6-12-7-31-34(10-12)9-11-4-13(23)17(25)14(24)5-11/h4-5,7-8,10,15,18-19H,3,6,9H2,1-2H3,(H,29,30,32)/t15-,19?/m0/s1 |
| InChIKey | WKMQETUDILDKGG-FUKCDUGKSA-N |
| XLogP | 3.87 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.45 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|