C22H26F3N7O — CID 153355462
5,8-dimethyl-2-[[1-[(3,4,5-trifluorophenyl)methyl]pyrazol-4-yl]methylamino]-7H-pteridin-6-one;propane (PubChem CID 153355462) has the molecular formula C22H26F3N7O and a molecular weight of 461.49 g/mol. Its IUPAC name is 5,8-dimethyl-2-[[1-[(3,4,5-trifluorophenyl)methyl]pyrazol-4-yl]methylamino]-7H-pteridin-6-one;propane.
| Compound Name | 5,8-dimethyl-2-[[1-[(3,4,5-trifluorophenyl)methyl]pyrazol-4-yl]methylamino]-7H-pteridin-6-one;propane |
|---|---|
| PubChem CID | 153355462 |
| Molecular Formula | C22H26F3N7O |
| Molecular Weight | 461.49 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | 5,8-dimethyl-2-[[1-[(3,4,5-trifluorophenyl)methyl]pyrazol-4-yl]methylamino]-7H-pteridin-6-one;propane |
| SMILES | CCC.CN1CC(=O)N(C)c2cnc(NCc3cnn(Cc4cc(F)c(F)c(F)c4)c3)nc21 |
| InChI | InChI=1S/C19H18F3N7O.C3H8/c1-27-10-16(30)28(2)15-7-24-19(26-18(15)27)23-5-12-6-25-29(9-12)8-11-3-13(20)17(22)14(21)4-11;1-3-2/h3-4,6-7,9H,5,8,10H2,1-2H3,(H,23,24,26);3H2,1-2H3 |
| InChIKey | SDRYGLUFVDSSCK-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.49 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|