C15H18N6O3S — CID 146202280
4-[[(5,8-dimethyl-6-oxo-7H-pteridin-2-yl)amino]methyl]benzenesulfonamide (PubChem CID 146202280) has the molecular formula C15H18N6O3S and a molecular weight of 362.42 g/mol. Its IUPAC name is 4-[[(5,8-dimethyl-6-oxo-7H-pteridin-2-yl)amino]methyl]benzenesulfonamide.
| Compound Name | 4-[[(5,8-dimethyl-6-oxo-7H-pteridin-2-yl)amino]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 146202280 |
| Molecular Formula | C15H18N6O3S |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 4-[[(5,8-dimethyl-6-oxo-7H-pteridin-2-yl)amino]methyl]benzenesulfonamide |
| SMILES | CN1CC(=O)N(C)c2cnc(NCc3ccc(S(N)(=O)=O)cc3)nc21 |
| InChI | InChI=1S/C15H18N6O3S/c1-20-9-13(22)21(2)12-8-18-15(19-14(12)20)17-7-10-3-5-11(6-4-10)25(16,23)24/h3-6,8H,7,9H2,1-2H3,(H2,16,23,24)(H,17,18,19) |
| InChIKey | VHCWODGVYLXRKU-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |